C15H11F3N2O4 — CID 7833989
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 7833989) has the molecular formula C15H11F3N2O4 and a molecular weight of 340.26 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7833989 |
| Molecular Formula | C15H11F3N2O4 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc[n+]([O-])cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H11F3N2O4/c1-8(24-15(22)9-4-6-20(23)7-5-9)14(21)19-11-3-2-10(16)12(17)13(11)18/h2-8H,1H3,(H,19,21)/t8-/m0/s1 |
| InChIKey | QVBXMTQWBRPWMD-QMMMGPOBSA-N |
| XLogP | 1.92 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|