C17H12F3NO4 — CID 7966512
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-formylbenzoate (PubChem CID 7966512) has the molecular formula C17H12F3NO4 and a molecular weight of 351.28 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-formylbenzoate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-formylbenzoate |
|---|---|
| PubChem CID | 7966512 |
| Molecular Formula | C17H12F3NO4 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-formylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C=O)cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H12F3NO4/c1-9(25-17(24)11-4-2-10(8-22)3-5-11)16(23)21-13-7-6-12(18)14(19)15(13)20/h2-9H,1H3,(H,21,23)/t9-/m1/s1 |
| InChIKey | GQAICYWWOUHUFZ-SECBINFHSA-N |
| XLogP | 3.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|