C17H14FNO4 — CID 7669485
[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-formylbenzoate (PubChem CID 7669485) has the molecular formula C17H14FNO4 and a molecular weight of 315.30 g/mol. Its IUPAC name is [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-formylbenzoate.
| Compound Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-formylbenzoate |
|---|---|
| PubChem CID | 7669485 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-formylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C=O)cc1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C17H14FNO4/c1-11(16(21)19-15-5-3-2-4-14(15)18)23-17(22)13-8-6-12(10-20)7-9-13/h2-11H,1H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | QCQYCMHWSAYWRM-LLVKDONJSA-N |
| XLogP | 2.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|