C13H16FNO3 — CID 46790194
[1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-methylpropanoate (PubChem CID 46790194) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is [1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-methylpropanoate.
| Compound Name | [1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 46790194 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | [1-(2-fluoroanilino)-1-oxopropan-2-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(C)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C13H16FNO3/c1-8(2)13(17)18-9(3)12(16)15-11-7-5-4-6-10(11)14/h4-9H,1-3H3,(H,15,16) |
| InChIKey | WPCFRAKDLLBASK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |