C23H18FNO4 — CID 2606399
[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-benzoylbenzoate (PubChem CID 2606399) has the molecular formula C23H18FNO4 and a molecular weight of 391.40 g/mol. Its IUPAC name is [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-benzoylbenzoate.
| Compound Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 2606399 |
| Molecular Formula | C23H18FNO4 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-benzoylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C(=O)c2ccccc2)cc1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C23H18FNO4/c1-15(22(27)25-20-10-6-5-9-19(20)24)29-23(28)18-13-11-17(12-14-18)21(26)16-7-3-2-4-8-16/h2-15H,1H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | YBMVLDPQNJFTEX-OAHLLOKOSA-N |
| XLogP | 4.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |