C18H15F3N2O4 — CID 7949869
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-acetamidobenzoate (PubChem CID 7949869) has the molecular formula C18H15F3N2O4 and a molecular weight of 380.32 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-acetamidobenzoate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 7949869 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)O[C@H](C)C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H15F3N2O4/c1-9(17(25)23-14-8-7-13(19)15(20)16(14)21)27-18(26)11-3-5-12(6-4-11)22-10(2)24/h3-9H,1-2H3,(H,22,24)(H,23,25)/t9-/m1/s1 |
| InChIKey | MDQJUYWUUKTOEU-SECBINFHSA-N |
| XLogP | 3.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|