C17H12F5NO4 — CID 7234289
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-(difluoromethoxy)benzoate (PubChem CID 7234289) has the molecular formula C17H12F5NO4 and a molecular weight of 389.28 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-(difluoromethoxy)benzoate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 7234289 |
| Molecular Formula | C17H12F5NO4 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-(difluoromethoxy)benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(OC(F)F)cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H12F5NO4/c1-8(15(24)23-12-7-6-11(18)13(19)14(12)20)26-16(25)9-2-4-10(5-3-9)27-17(21)22/h2-8,17H,1H3,(H,23,24)/t8-/m0/s1 |
| InChIKey | XWXBWUTYNREYBN-QMMMGPOBSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|