C22H16F3NO3 — CID 7717807
(2S)-2-(4-benzoylphenoxy)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7717807) has the molecular formula C22H16F3NO3 and a molecular weight of 399.37 g/mol. Its IUPAC name is (2S)-2-(4-benzoylphenoxy)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-(4-benzoylphenoxy)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7717807 |
| Molecular Formula | C22H16F3NO3 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (2S)-2-(4-benzoylphenoxy)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@H](Oc1ccc(C(=O)c2ccccc2)cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H16F3NO3/c1-13(22(28)26-18-12-11-17(23)19(24)20(18)25)29-16-9-7-15(8-10-16)21(27)14-5-3-2-4-6-14/h2-13H,1H3,(H,26,28)/t13-/m0/s1 |
| InChIKey | RTRDJSSCJNBKGA-ZDUSSCGKSA-N |
| XLogP | 4.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|