C17H12F3N3O3 — CID 7556105
(2R)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7556105) has the molecular formula C17H12F3N3O3 and a molecular weight of 363.30 g/mol. Its IUPAC name is (2R)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7556105 |
| Molecular Formula | C17H12F3N3O3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (2R)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@@H](Oc1ccc(-c2nnco2)cc1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H12F3N3O3/c1-9(16(24)22-13-7-6-12(18)14(19)15(13)20)26-11-4-2-10(3-5-11)17-23-21-8-25-17/h2-9H,1H3,(H,22,24)/t9-/m1/s1 |
| InChIKey | LXTBQOGEUKHYHE-SECBINFHSA-N |
| XLogP | 3.56 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|