C18H16N4O6 — CID 8528122
(2R)-N-(2-methoxy-5-nitrophenyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]propanamide (PubChem CID 8528122) has the molecular formula C18H16N4O6 and a molecular weight of 384.35 g/mol. Its IUPAC name is (2R)-N-(2-methoxy-5-nitrophenyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]propanamide.
| Compound Name | (2R)-N-(2-methoxy-5-nitrophenyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]propanamide |
|---|---|
| PubChem CID | 8528122 |
| Molecular Formula | C18H16N4O6 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (2R)-N-(2-methoxy-5-nitrophenyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)Oc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C18H16N4O6/c1-11(28-14-6-3-12(4-7-14)18-21-19-10-27-18)17(23)20-15-9-13(22(24)25)5-8-16(15)26-2/h3-11H,1-2H3,(H,20,23)/t11-/m1/s1 |
| InChIKey | NDBOSMPIUMMBTG-LLVKDONJSA-N |
| XLogP | 3.06 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|