C17H14F3NO4 — CID 7965434
methyl 4-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]oxybenzoate (PubChem CID 7965434) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is methyl 4-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]oxybenzoate.
| Compound Name | methyl 4-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 7965434 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | methyl 4-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(O[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H14F3NO4/c1-9(25-11-5-3-10(4-6-11)17(23)24-2)16(22)21-13-8-7-12(18)14(19)15(13)20/h3-9H,1-2H3,(H,21,22)/t9-/m0/s1 |
| InChIKey | SFKLCSZCNRGLOM-VIFPVBQESA-N |
| XLogP | 3.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|