C19H20N2O5 — CID 7965103
methyl 4-[(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]oxybenzoate (PubChem CID 7965103) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 4-[(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]oxybenzoate.
| Compound Name | methyl 4-[(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 7965103 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | methyl 4-[(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(O[C@H](C)C(=O)Nc2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-12(26-17-10-4-14(5-11-17)19(24)25-3)18(23)21-16-8-6-15(7-9-16)20-13(2)22/h4-12H,1-3H3,(H,20,22)(H,21,23)/t12-/m1/s1 |
| InChIKey | WPLIZGOVXFWVGC-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |