C19H20ClNO4 — CID 19191615
methyl 4-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate (PubChem CID 19191615) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is methyl 4-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate.
| Compound Name | methyl 4-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate |
|---|---|
| PubChem CID | 19191615 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | methyl 4-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(C)Oc2cc(C)c(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C19H20ClNO4/c1-11-9-16(10-12(2)17(11)20)25-13(3)18(22)21-15-7-5-14(6-8-15)19(23)24-4/h5-10,13H,1-4H3,(H,21,22) |
| InChIKey | UYYBKZCRWYOUGS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |