C24H30ClNO4 — CID 19191626
hexyl 4-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate (PubChem CID 19191626) has the molecular formula C24H30ClNO4 and a molecular weight of 431.96 g/mol. Its IUPAC name is hexyl 4-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate.
| Compound Name | hexyl 4-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate |
|---|---|
| PubChem CID | 19191626 |
| Molecular Formula | C24H30ClNO4 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | hexyl 4-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(NC(=O)C(C)Oc2cc(C)c(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C24H30ClNO4/c1-5-6-7-8-13-29-24(28)19-9-11-20(12-10-19)26-23(27)18(4)30-21-14-16(2)22(25)17(3)15-21/h9-12,14-15,18H,5-8,13H2,1-4H3,(H,26,27) |
| InChIKey | GEHIEJDWZVLRHG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|