C20H23NO4 — CID 7984457
butyl 4-[(2R)-1-anilino-1-oxopropan-2-yl]oxybenzoate (PubChem CID 7984457) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is butyl 4-[(2R)-1-anilino-1-oxopropan-2-yl]oxybenzoate.
| Compound Name | butyl 4-[(2R)-1-anilino-1-oxopropan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 7984457 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | butyl 4-[(2R)-1-anilino-1-oxopropan-2-yl]oxybenzoate |
| SMILES | CCCCOC(=O)c1ccc(O[C@H](C)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-3-4-14-24-20(23)16-10-12-18(13-11-16)25-15(2)19(22)21-17-8-6-5-7-9-17/h5-13,15H,3-4,14H2,1-2H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | RUIRLGMXJIMXOA-OAHLLOKOSA-N |
| XLogP | 4.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|