C22H27NO4 — CID 5078511
(1-anilino-1-oxopropan-2-yl) 4-hexoxybenzoate (PubChem CID 5078511) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (1-anilino-1-oxopropan-2-yl) 4-hexoxybenzoate.
| Compound Name | (1-anilino-1-oxopropan-2-yl) 4-hexoxybenzoate |
|---|---|
| PubChem CID | 5078511 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (1-anilino-1-oxopropan-2-yl) 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)OC(C)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-3-4-5-9-16-26-20-14-12-18(13-15-20)22(25)27-17(2)21(24)23-19-10-7-6-8-11-19/h6-8,10-15,17H,3-5,9,16H2,1-2H3,(H,23,24) |
| InChIKey | ZIUJPQKEPQBVDE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|