C23H28ClNO4 — CID 5066963
[1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 4-hexoxybenzoate (PubChem CID 5066963) has the molecular formula C23H28ClNO4 and a molecular weight of 417.93 g/mol. Its IUPAC name is [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 4-hexoxybenzoate.
| Compound Name | [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 4-hexoxybenzoate |
|---|---|
| PubChem CID | 5066963 |
| Molecular Formula | C23H28ClNO4 |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)OC(C)C(=O)Nc2cc(Cl)ccc2C)cc1 |
| InChI | InChI=1S/C23H28ClNO4/c1-4-5-6-7-14-28-20-12-9-18(10-13-20)23(27)29-17(3)22(26)25-21-15-19(24)11-8-16(21)2/h8-13,15,17H,4-7,14H2,1-3H3,(H,25,26) |
| InChIKey | XVAYITKUBVFUSL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|