C23H29NO5 — CID 53267194
pentyl 4-[2-(4-ethoxyphenoxy)propanoylamino]benzoate (PubChem CID 53267194) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is pentyl 4-[2-(4-ethoxyphenoxy)propanoylamino]benzoate.
| Compound Name | pentyl 4-[2-(4-ethoxyphenoxy)propanoylamino]benzoate |
|---|---|
| PubChem CID | 53267194 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | pentyl 4-[2-(4-ethoxyphenoxy)propanoylamino]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(NC(=O)C(C)Oc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C23H29NO5/c1-4-6-7-16-28-23(26)18-8-10-19(11-9-18)24-22(25)17(3)29-21-14-12-20(13-15-21)27-5-2/h8-15,17H,4-7,16H2,1-3H3,(H,24,25) |
| InChIKey | SPESWDHCNVAFFE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|