C22H29NO4 — CID 8757311
(2R)-N-(4-hexoxyphenyl)-2-(4-methoxyphenoxy)propanamide (PubChem CID 8757311) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2R)-N-(4-hexoxyphenyl)-2-(4-methoxyphenoxy)propanamide.
| Compound Name | (2R)-N-(4-hexoxyphenyl)-2-(4-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 8757311 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (2R)-N-(4-hexoxyphenyl)-2-(4-methoxyphenoxy)propanamide |
| SMILES | CCCCCCOc1ccc(NC(=O)[C@@H](C)Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H29NO4/c1-4-5-6-7-16-26-20-10-8-18(9-11-20)23-22(24)17(2)27-21-14-12-19(25-3)13-15-21/h8-15,17H,4-7,16H2,1-3H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | NKUNENGMSGPIMO-QGZVFWFLSA-N |
| XLogP | 5.06 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|