C26H31NO3 — CID 54790083
(2S)-N-(4-hexoxyphenyl)-2-(6-methoxynaphthalen-2-yl)propanamide (PubChem CID 54790083) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is (2S)-N-(4-hexoxyphenyl)-2-(6-methoxynaphthalen-2-yl)propanamide.
| Compound Name | (2S)-N-(4-hexoxyphenyl)-2-(6-methoxynaphthalen-2-yl)propanamide |
|---|---|
| PubChem CID | 54790083 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (2S)-N-(4-hexoxyphenyl)-2-(6-methoxynaphthalen-2-yl)propanamide |
| SMILES | CCCCCCOc1ccc(NC(=O)[C@@H](C)c2ccc3cc(OC)ccc3c2)cc1 |
| InChI | InChI=1S/C26H31NO3/c1-4-5-6-7-16-30-24-14-11-23(12-15-24)27-26(28)19(2)20-8-9-22-18-25(29-3)13-10-21(22)17-20/h8-15,17-19H,4-7,16H2,1-3H3,(H,27,28)/t19-/m0/s1 |
| InChIKey | FZOYDKWSGHGKRD-IBGZPJMESA-N |
| XLogP | 6.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|