C21H18N2O2 — CID 26689476
(2S)-N-(4-cyanophenyl)-2-(6-methoxynaphthalen-2-yl)propanamide (PubChem CID 26689476) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (2S)-N-(4-cyanophenyl)-2-(6-methoxynaphthalen-2-yl)propanamide.
| Compound Name | (2S)-N-(4-cyanophenyl)-2-(6-methoxynaphthalen-2-yl)propanamide |
|---|---|
| PubChem CID | 26689476 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (2S)-N-(4-cyanophenyl)-2-(6-methoxynaphthalen-2-yl)propanamide |
| SMILES | COc1ccc2cc([C@H](C)C(=O)Nc3ccc(C#N)cc3)ccc2c1 |
| InChI | InChI=1S/C21H18N2O2/c1-14(21(24)23-19-8-3-15(13-22)4-9-19)16-5-6-18-12-20(25-2)10-7-17(18)11-16/h3-12,14H,1-2H3,(H,23,24)/t14-/m0/s1 |
| InChIKey | PCQZHNXYVUCGFV-AWEZNQCLSA-N |
| XLogP | 4.46 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |