(4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate

C22H19NO3 — CID 84881337

IUPAC(4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate
SMILESCOc1ccc2cc(C(C)C(=O)OCc3ccc(C#N)cc3)ccc2c1
InChIInChI=1S/C22H19NO3/c1-15(22(24)26-14-17-5-3-16(13-23)4-6-17)18-7-8-20-12-21(25-2)10-9-19(20)11-18/h3-12,15H,14H2,1-2H3
InChIKeyBSIPMPMXHRZAMV-UHFFFAOYSA-N
MW345.40 g/mol
LogP4.57
Rot. Bonds5

About (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate

(4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 84881337) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate.

Molecular Properties

Compound Name(4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate
PubChem CID84881337
Molecular FormulaC22H19NO3
Molecular Weight345.40 g/mol
Exact Mass345.14
IUPAC Name(4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate
SMILESCOc1ccc2cc(C(C)C(=O)OCc3ccc(C#N)cc3)ccc2c1
InChIInChI=1S/C22H19NO3/c1-15(22(24)26-14-17-5-3-16(13-23)4-6-17)18-7-8-20-12-21(25-2)10-9-19(20)11-18/h3-12,15H,14H2,1-2H3
InChIKeyBSIPMPMXHRZAMV-UHFFFAOYSA-N
XLogP4.57
TPSA59.32 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.40
LogP ≤ 54.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate?
The IUPAC name of (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate (CID 84881337) is (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate.
What is the SMILES notation for (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate?
The canonical SMILES for (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate is COc1ccc2cc(C(C)C(=O)OCc3ccc(C#N)cc3)ccc2c1.
What is the InChIKey of (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate?
The InChIKey is BSIPMPMXHRZAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO3/c1-15(22(24)26-14-17-5-3-16(13-23)4-6-17)18-7-8-20-12-21(25-2)10-9-19(20)11-18/h3-12,15H,14H2,1-2H3.
What are the key properties of (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate?
(4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate has a molecular weight of 345.40 g/mol, XLogP of 4.57, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 84881337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).