About (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate
(4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 84881337) has the molecular formula C22H19NO3
and a molecular weight of 345.40 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate |
| PubChem CID | 84881337 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc(C(C)C(=O)OCc3ccc(C#N)cc3)ccc2c1 |
| InChI | InChI=1S/C22H19NO3/c1-15(22(24)26-14-17-5-3-16(13-23)4-6-17)18-7-8-20-12-21(25-2)10-9-19(20)11-18/h3-12,15H,14H2,1-2H3 |
| InChIKey | BSIPMPMXHRZAMV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate?
The IUPAC name of (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate (CID 84881337) is (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate.
What is the SMILES notation for (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate?
The canonical SMILES for (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate is COc1ccc2cc(C(C)C(=O)OCc3ccc(C#N)cc3)ccc2c1.
What is the InChIKey of (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate?
The InChIKey is BSIPMPMXHRZAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO3/c1-15(22(24)26-14-17-5-3-16(13-23)4-6-17)18-7-8-20-12-21(25-2)10-9-19(20)11-18/h3-12,15H,14H2,1-2H3.
What are the key properties of (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate?
(4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate has a molecular weight of 345.40 g/mol, XLogP of 4.57, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 2-(6-methoxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 84881337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).