About 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate
3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 164622703) has the molecular formula C18H19NO3Se
and a molecular weight of 376.31 g/mol. Its IUPAC name is 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate |
| PubChem CID | 164622703 |
| Molecular Formula | C18H19NO3Se |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc(C(C)C(=O)OCCC[Se]C#N)ccc2c1 |
| InChI | InChI=1S/C18H19NO3Se/c1-13(18(20)22-8-3-9-23-12-19)14-4-5-16-11-17(21-2)7-6-15(16)10-14/h4-7,10-11,13H,3,8-9H2,1-2H3 |
| InChIKey | TXQLBEQQLYHHKF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate?
The IUPAC name of 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate (CID 164622703) is 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate.
What is the SMILES notation for 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate?
The canonical SMILES for 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate is COc1ccc2cc(C(C)C(=O)OCCC[Se]C#N)ccc2c1.
What is the InChIKey of 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate?
The InChIKey is TXQLBEQQLYHHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3Se/c1-13(18(20)22-8-3-9-23-12-19)14-4-5-16-11-17(21-2)7-6-15(16)10-14/h4-7,10-11,13H,3,8-9H2,1-2H3.
What are the key properties of 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate?
3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate has a molecular weight of 376.31 g/mol, XLogP of 3.49, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-selenocyanatopropyl 2-(6-methoxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 164622703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).