About 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate
2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 51351147) has the molecular formula C16H17ClO5S
and a molecular weight of 356.83 g/mol. Its IUPAC name is 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| PubChem CID | 51351147 |
| Molecular Formula | C16H17ClO5S |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)OCCS(=O)(=O)Cl)ccc2c1 |
| InChI | InChI=1S/C16H17ClO5S/c1-11(16(18)22-7-8-23(17,19)20)12-3-4-14-10-15(21-2)6-5-13(14)9-12/h3-6,9-11H,7-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | NQGOSACHCUAKHO-NSHDSACASA-N |
| XLogP | 3.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
The IUPAC name of 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (CID 51351147) is 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
What is the SMILES notation for 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
The canonical SMILES for 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate is COc1ccc2cc([C@H](C)C(=O)OCCS(=O)(=O)Cl)ccc2c1.
What is the InChIKey of 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
The InChIKey is NQGOSACHCUAKHO-NSHDSACASA-N. The full InChI is InChI=1S/C16H17ClO5S/c1-11(16(18)22-7-8-23(17,19)20)12-3-4-14-10-15(21-2)6-5-13(14)9-12/h3-6,9-11H,7-8H2,1-2H3/t11-/m0/s1.
What are the key properties of 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate has a molecular weight of 356.83 g/mol, XLogP of 3.06, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorosulfonylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 51351147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).