C18H21NO8S — CID 10409347
2-(2-nitrooxyethylsulfonyl)ethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 10409347) has the molecular formula C18H21NO8S and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-(2-nitrooxyethylsulfonyl)ethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | 2-(2-nitrooxyethylsulfonyl)ethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 10409347 |
| Molecular Formula | C18H21NO8S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-(2-nitrooxyethylsulfonyl)ethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)OCCS(=O)(=O)CCO[N+](=O)[O-])ccc2c1 |
| InChI | InChI=1S/C18H21NO8S/c1-13(14-3-4-16-12-17(25-2)6-5-15(16)11-14)18(20)26-7-9-28(23,24)10-8-27-19(21)22/h3-6,11-13H,7-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | YJKUNGYWTYKVON-ZDUSSCGKSA-N |
| XLogP | 2.12 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|