C20H23NO10S — CID 90905916
1-O-methyl 3-O-[2-(2-nitrooxyethylsulfonyl)ethyl] 2-(6-methoxynaphthalen-2-yl)-2-methylpropanedioate (PubChem CID 90905916) has the molecular formula C20H23NO10S and a molecular weight of 469.47 g/mol. Its IUPAC name is 1-O-methyl 3-O-[2-(2-nitrooxyethylsulfonyl)ethyl] 2-(6-methoxynaphthalen-2-yl)-2-methylpropanedioate.
| Compound Name | 1-O-methyl 3-O-[2-(2-nitrooxyethylsulfonyl)ethyl] 2-(6-methoxynaphthalen-2-yl)-2-methylpropanedioate |
|---|---|
| PubChem CID | 90905916 |
| Molecular Formula | C20H23NO10S |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 1-O-methyl 3-O-[2-(2-nitrooxyethylsulfonyl)ethyl] 2-(6-methoxynaphthalen-2-yl)-2-methylpropanedioate |
| SMILES | COC(=O)C(C)(C(=O)OCCS(=O)(=O)CCO[N+](=O)[O-])c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C20H23NO10S/c1-20(18(22)29-3,16-6-4-15-13-17(28-2)7-5-14(15)12-16)19(23)30-8-10-32(26,27)11-9-31-21(24)25/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | UHUBVSKWXLBQHH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 148.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|