C17H18N2O9 — CID 87079878
(2S,4S)-2-(6-methoxynaphthalen-2-yl)-2-methyl-4,5-dinitrooxypentanoic acid (PubChem CID 87079878) has the molecular formula C17H18N2O9 and a molecular weight of 394.34 g/mol. Its IUPAC name is (2S,4S)-2-(6-methoxynaphthalen-2-yl)-2-methyl-4,5-dinitrooxypentanoic acid.
| Compound Name | (2S,4S)-2-(6-methoxynaphthalen-2-yl)-2-methyl-4,5-dinitrooxypentanoic acid |
|---|---|
| PubChem CID | 87079878 |
| Molecular Formula | C17H18N2O9 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (2S,4S)-2-(6-methoxynaphthalen-2-yl)-2-methyl-4,5-dinitrooxypentanoic acid |
| SMILES | COc1ccc2cc([C@](C)(C[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-])C(=O)O)ccc2c1 |
| InChI | InChI=1S/C17H18N2O9/c1-17(16(20)21,9-15(28-19(24)25)10-27-18(22)23)13-5-3-12-8-14(26-2)6-4-11(12)7-13/h3-8,15H,9-10H2,1-2H3,(H,20,21)/t15-,17-/m0/s1 |
| InChIKey | JFYQQBDWECXVDN-RDJZCZTQSA-N |
| XLogP | 2.37 |
| TPSA | 151.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|