C20H24N2O7 — CID 91165232
methyl (2S)-2-(6-methoxynaphthalen-2-yl)-2-methyl-3-[methyl(3-nitrooxypropyl)amino]-3-oxopropanoate (PubChem CID 91165232) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is methyl (2S)-2-(6-methoxynaphthalen-2-yl)-2-methyl-3-[methyl(3-nitrooxypropyl)amino]-3-oxopropanoate.
| Compound Name | methyl (2S)-2-(6-methoxynaphthalen-2-yl)-2-methyl-3-[methyl(3-nitrooxypropyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 91165232 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | methyl (2S)-2-(6-methoxynaphthalen-2-yl)-2-methyl-3-[methyl(3-nitrooxypropyl)amino]-3-oxopropanoate |
| SMILES | COC(=O)[C@](C)(C(=O)N(C)CCCO[N+](=O)[O-])c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C20H24N2O7/c1-20(19(24)28-4,18(23)21(2)10-5-11-29-22(25)26)16-8-6-15-13-17(27-3)9-7-14(15)12-16/h6-9,12-13H,5,10-11H2,1-4H3/t20-/m0/s1 |
| InChIKey | YTQLRPZGZIKDFT-FQEVSTJZSA-N |
| XLogP | 2.34 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|