C22H26N2O9 — CID 66624586
(2S)-2-(6-methoxynaphthalen-2-yl)-5-[methyl-[2-(3-nitrooxypropoxy)-2-oxoethyl]amino]-5-oxopentanoic acid (PubChem CID 66624586) has the molecular formula C22H26N2O9 and a molecular weight of 462.46 g/mol. Its IUPAC name is (2S)-2-(6-methoxynaphthalen-2-yl)-5-[methyl-[2-(3-nitrooxypropoxy)-2-oxoethyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-(6-methoxynaphthalen-2-yl)-5-[methyl-[2-(3-nitrooxypropoxy)-2-oxoethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 66624586 |
| Molecular Formula | C22H26N2O9 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (2S)-2-(6-methoxynaphthalen-2-yl)-5-[methyl-[2-(3-nitrooxypropoxy)-2-oxoethyl]amino]-5-oxopentanoic acid |
| SMILES | COc1ccc2cc(C(CCC(=O)N(C)CC(=O)OCCCO[N+](=O)[O-])C(=O)O)ccc2c1 |
| InChI | InChI=1S/C22H26N2O9/c1-23(14-21(26)32-10-3-11-33-24(29)30)20(25)9-8-19(22(27)28)17-5-4-16-13-18(31-2)7-6-15(16)12-17/h4-7,12-13,19H,3,8-11,14H2,1-2H3,(H,27,28) |
| InChIKey | UNCXIJYUTTYWDB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|