C26H25NO9 — CID 66624187
(2S)-2-(6-methoxynaphthalen-2-yl)-6-[2-[4-(nitrooxymethyl)phenyl]acetyl]oxy-5-oxohexanoic acid (PubChem CID 66624187) has the molecular formula C26H25NO9 and a molecular weight of 495.48 g/mol. Its IUPAC name is (2S)-2-(6-methoxynaphthalen-2-yl)-6-[2-[4-(nitrooxymethyl)phenyl]acetyl]oxy-5-oxohexanoic acid.
| Compound Name | (2S)-2-(6-methoxynaphthalen-2-yl)-6-[2-[4-(nitrooxymethyl)phenyl]acetyl]oxy-5-oxohexanoic acid |
|---|---|
| PubChem CID | 66624187 |
| Molecular Formula | C26H25NO9 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | (2S)-2-(6-methoxynaphthalen-2-yl)-6-[2-[4-(nitrooxymethyl)phenyl]acetyl]oxy-5-oxohexanoic acid |
| SMILES | COc1ccc2cc([C@H](CCC(=O)COC(=O)Cc3ccc(CO[N+](=O)[O-])cc3)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C26H25NO9/c1-34-23-10-8-19-13-21(7-6-20(19)14-23)24(26(30)31)11-9-22(28)16-35-25(29)12-17-2-4-18(5-3-17)15-36-27(32)33/h2-8,10,13-14,24H,9,11-12,15-16H2,1H3,(H,30,31)/t24-/m0/s1 |
| InChIKey | NPLHNVCDPXFRBJ-DEOSSOPVSA-N |
| XLogP | 3.86 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|