C22H21NO2S — CID 88898546
4-[3-(6-methoxynaphthalen-2-yl)-2-oxobutyl]benzenecarbothioamide (PubChem CID 88898546) has the molecular formula C22H21NO2S and a molecular weight of 363.48 g/mol. Its IUPAC name is 4-[3-(6-methoxynaphthalen-2-yl)-2-oxobutyl]benzenecarbothioamide.
| Compound Name | 4-[3-(6-methoxynaphthalen-2-yl)-2-oxobutyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 88898546 |
| Molecular Formula | C22H21NO2S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-[3-(6-methoxynaphthalen-2-yl)-2-oxobutyl]benzenecarbothioamide |
| SMILES | COc1ccc2cc(C(C)C(=O)Cc3ccc(C(N)=S)cc3)ccc2c1 |
| InChI | InChI=1S/C22H21NO2S/c1-14(21(24)11-15-3-5-16(6-4-15)22(23)26)17-7-8-19-13-20(25-2)10-9-18(19)12-17/h3-10,12-14H,11H2,1-2H3,(H2,23,26) |
| InChIKey | XPXIAAMSYCGUJV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|