C18H20N2O10 — CID 87270600
(2S)-7-hydroxy-2-(6-methoxynaphthalen-2-yl)-5,6-dinitrooxyheptanoic acid (PubChem CID 87270600) has the molecular formula C18H20N2O10 and a molecular weight of 424.36 g/mol. Its IUPAC name is (2S)-7-hydroxy-2-(6-methoxynaphthalen-2-yl)-5,6-dinitrooxyheptanoic acid.
| Compound Name | (2S)-7-hydroxy-2-(6-methoxynaphthalen-2-yl)-5,6-dinitrooxyheptanoic acid |
|---|---|
| PubChem CID | 87270600 |
| Molecular Formula | C18H20N2O10 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (2S)-7-hydroxy-2-(6-methoxynaphthalen-2-yl)-5,6-dinitrooxyheptanoic acid |
| SMILES | COc1ccc2cc([C@H](CCC(O[N+](=O)[O-])C(CO)O[N+](=O)[O-])C(=O)O)ccc2c1 |
| InChI | InChI=1S/C18H20N2O10/c1-28-14-5-4-11-8-13(3-2-12(11)9-14)15(18(22)23)6-7-16(29-19(24)25)17(10-21)30-20(26)27/h2-5,8-9,15-17,21H,6-7,10H2,1H3,(H,22,23)/t15-,16?,17?/m0/s1 |
| InChIKey | HCSBBKMXDRISDL-GTPINHCMSA-N |
| XLogP | 1.94 |
| TPSA | 171.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|