C37H42O6 — CID 69251620
2-(6-methoxynaphthalen-2-yl)hept-6-enoic acid;methyl 2-(6-methoxynaphthalen-2-yl)hept-6-enoate (PubChem CID 69251620) has the molecular formula C37H42O6 and a molecular weight of 582.74 g/mol. Its IUPAC name is 2-(6-methoxynaphthalen-2-yl)hept-6-enoic acid;methyl 2-(6-methoxynaphthalen-2-yl)hept-6-enoate.
| Compound Name | 2-(6-methoxynaphthalen-2-yl)hept-6-enoic acid;methyl 2-(6-methoxynaphthalen-2-yl)hept-6-enoate |
|---|---|
| PubChem CID | 69251620 |
| Molecular Formula | C37H42O6 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | 2-(6-methoxynaphthalen-2-yl)hept-6-enoic acid;methyl 2-(6-methoxynaphthalen-2-yl)hept-6-enoate |
| SMILES | C=CCCCC(C(=O)O)c1ccc2cc(OC)ccc2c1.C=CCCCC(C(=O)OC)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C19H22O3.C18H20O3/c1-4-5-6-7-18(19(20)22-3)16-9-8-15-13-17(21-2)11-10-14(15)12-16;1-3-4-5-6-17(18(19)20)15-8-7-14-12-16(21-2)10-9-13(14)11-15/h4,8-13,18H,1,5-7H2,2-3H3;3,7-12,17H,1,4-6H2,2H3,(H,19,20) |
| InChIKey | BPMPOJQLGKNJPF-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|