C24H26O5 — CID 66624192
(2R)-5-hydroxy-2-(6-methoxynaphthalen-2-yl)-6-phenylmethoxyhexanoic acid (PubChem CID 66624192) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is (2R)-5-hydroxy-2-(6-methoxynaphthalen-2-yl)-6-phenylmethoxyhexanoic acid.
| Compound Name | (2R)-5-hydroxy-2-(6-methoxynaphthalen-2-yl)-6-phenylmethoxyhexanoic acid |
|---|---|
| PubChem CID | 66624192 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (2R)-5-hydroxy-2-(6-methoxynaphthalen-2-yl)-6-phenylmethoxyhexanoic acid |
| SMILES | COc1ccc2cc([C@@H](CCC(O)COCc3ccccc3)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C24H26O5/c1-28-22-11-9-18-13-20(8-7-19(18)14-22)23(24(26)27)12-10-21(25)16-29-15-17-5-3-2-4-6-17/h2-9,11,13-14,21,23,25H,10,12,15-16H2,1H3,(H,26,27)/t21?,23-/m1/s1 |
| InChIKey | MGSJBCCDDSZFDX-JFGZAKSSSA-N |
| XLogP | 4.37 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |