C18H22O5S — CID 6977010
(2R)-1-benzylsulfonyl-3-[(4-methoxyphenyl)methoxy]propan-2-ol (PubChem CID 6977010) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is (2R)-1-benzylsulfonyl-3-[(4-methoxyphenyl)methoxy]propan-2-ol.
| Compound Name | (2R)-1-benzylsulfonyl-3-[(4-methoxyphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 6977010 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (2R)-1-benzylsulfonyl-3-[(4-methoxyphenyl)methoxy]propan-2-ol |
| SMILES | COc1ccc(COC[C@@H](O)CS(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22O5S/c1-22-18-9-7-15(8-10-18)11-23-12-17(19)14-24(20,21)13-16-5-3-2-4-6-16/h2-10,17,19H,11-14H2,1H3/t17-/m1/s1 |
| InChIKey | SPTKCVZTIAUPHW-QGZVFWFLSA-N |
| XLogP | 2.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |