C18H21ClO5S — CID 6977014
(2R)-1-[(4-chlorophenyl)methylsulfonyl]-3-[(4-methoxyphenyl)methoxy]propan-2-ol (PubChem CID 6977014) has the molecular formula C18H21ClO5S and a molecular weight of 384.88 g/mol. Its IUPAC name is (2R)-1-[(4-chlorophenyl)methylsulfonyl]-3-[(4-methoxyphenyl)methoxy]propan-2-ol.
| Compound Name | (2R)-1-[(4-chlorophenyl)methylsulfonyl]-3-[(4-methoxyphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 6977014 |
| Molecular Formula | C18H21ClO5S |
| Molecular Weight | 384.88 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (2R)-1-[(4-chlorophenyl)methylsulfonyl]-3-[(4-methoxyphenyl)methoxy]propan-2-ol |
| SMILES | COc1ccc(COC[C@@H](O)CS(=O)(=O)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H21ClO5S/c1-23-18-8-4-14(5-9-18)10-24-11-17(20)13-25(21,22)12-15-2-6-16(19)7-3-15/h2-9,17,20H,10-13H2,1H3/t17-/m1/s1 |
| InChIKey | LWGDWIVCBASYEG-QGZVFWFLSA-N |
| XLogP | 2.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.88 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |