C17H19ClO4S — CID 3704416
2-(4-chlorophenyl)-1-[(4-methoxyphenyl)methylsulfonyl]propan-2-ol (PubChem CID 3704416) has the molecular formula C17H19ClO4S and a molecular weight of 354.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[(4-methoxyphenyl)methylsulfonyl]propan-2-ol.
| Compound Name | 2-(4-chlorophenyl)-1-[(4-methoxyphenyl)methylsulfonyl]propan-2-ol |
|---|---|
| PubChem CID | 3704416 |
| Molecular Formula | C17H19ClO4S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[(4-methoxyphenyl)methylsulfonyl]propan-2-ol |
| SMILES | COc1ccc(CS(=O)(=O)CC(C)(O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H19ClO4S/c1-17(19,14-5-7-15(18)8-6-14)12-23(20,21)11-13-3-9-16(22-2)10-4-13/h3-10,19H,11-12H2,1-2H3 |
| InChIKey | MQOSYSKVAGRKLG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |