C17H20O4S — CID 1474364
(2S)-1-[(4-methoxyphenyl)methylsulfonyl]-2-phenylpropan-2-ol (PubChem CID 1474364) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is (2S)-1-[(4-methoxyphenyl)methylsulfonyl]-2-phenylpropan-2-ol.
| Compound Name | (2S)-1-[(4-methoxyphenyl)methylsulfonyl]-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 1474364 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (2S)-1-[(4-methoxyphenyl)methylsulfonyl]-2-phenylpropan-2-ol |
| SMILES | COc1ccc(CS(=O)(=O)C[C@@](C)(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20O4S/c1-17(18,15-6-4-3-5-7-15)13-22(19,20)12-14-8-10-16(21-2)11-9-14/h3-11,18H,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | RWPJPGBTHGSPQM-QGZVFWFLSA-N |
| XLogP | 2.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |