C20H21Cl2IN2O4S — CID 69477796
2-[5,6-dichloro-1-(1-iodoethyl)benzimidazol-2-yl]-1-[(4-methoxyphenyl)methylsulfonyl]propan-2-ol (PubChem CID 69477796) has the molecular formula C20H21Cl2IN2O4S and a molecular weight of 583.28 g/mol. Its IUPAC name is 2-[5,6-dichloro-1-(1-iodoethyl)benzimidazol-2-yl]-1-[(4-methoxyphenyl)methylsulfonyl]propan-2-ol.
| Compound Name | 2-[5,6-dichloro-1-(1-iodoethyl)benzimidazol-2-yl]-1-[(4-methoxyphenyl)methylsulfonyl]propan-2-ol |
|---|---|
| PubChem CID | 69477796 |
| Molecular Formula | C20H21Cl2IN2O4S |
| Molecular Weight | 583.28 g/mol |
| Exact Mass | 581.96 |
| IUPAC Name | 2-[5,6-dichloro-1-(1-iodoethyl)benzimidazol-2-yl]-1-[(4-methoxyphenyl)methylsulfonyl]propan-2-ol |
| SMILES | COc1ccc(CS(=O)(=O)CC(C)(O)c2nc3cc(Cl)c(Cl)cc3n2C(C)I)cc1 |
| InChI | InChI=1S/C20H21Cl2IN2O4S/c1-12(23)25-18-9-16(22)15(21)8-17(18)24-19(25)20(2,26)11-30(27,28)10-13-4-6-14(29-3)7-5-13/h4-9,12,26H,10-11H2,1-3H3 |
| InChIKey | NSUJXENIMYCEKJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|