C30H40O6SSi — CID 11135454
[4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonylmethyl]phenyl]-bis(4-methoxyphenyl)methanol (PubChem CID 11135454) has the molecular formula C30H40O6SSi and a molecular weight of 556.80 g/mol. Its IUPAC name is [4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonylmethyl]phenyl]-bis(4-methoxyphenyl)methanol.
| Compound Name | [4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonylmethyl]phenyl]-bis(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 11135454 |
| Molecular Formula | C30H40O6SSi |
| Molecular Weight | 556.80 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | [4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonylmethyl]phenyl]-bis(4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)(c2ccc(CS(=O)(=O)CCO[Si](C)(C)C(C)(C)C)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H40O6SSi/c1-29(2,3)38(6,7)36-20-21-37(32,33)22-23-8-10-24(11-9-23)30(31,25-12-16-27(34-4)17-13-25)26-14-18-28(35-5)19-15-26/h8-19,31H,20-22H2,1-7H3 |
| InChIKey | ODWAGXHQZWDDGD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.80 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|