C28H42O6Si — CID 25191553
(3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-bis[(4-methoxyphenyl)methoxy]hexan-2-one (PubChem CID 25191553) has the molecular formula C28H42O6Si and a molecular weight of 502.72 g/mol. Its IUPAC name is (3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-bis[(4-methoxyphenyl)methoxy]hexan-2-one.
| Compound Name | (3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-bis[(4-methoxyphenyl)methoxy]hexan-2-one |
|---|---|
| PubChem CID | 25191553 |
| Molecular Formula | C28H42O6Si |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (3R,4S)-6-[tert-butyl(dimethyl)silyl]oxy-3,4-bis[(4-methoxyphenyl)methoxy]hexan-2-one |
| SMILES | COc1ccc(CO[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccc(OC)cc2)C(C)=O)cc1 |
| InChI | InChI=1S/C28H42O6Si/c1-21(29)27(33-20-23-11-15-25(31-6)16-12-23)26(17-18-34-35(7,8)28(2,3)4)32-19-22-9-13-24(30-5)14-10-22/h9-16,26-27H,17-20H2,1-8H3/t26-,27-/m0/s1 |
| InChIKey | PBQFDYIWIBNRRC-SVBPBHIXSA-N |
| XLogP | 6.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|