C18H32O4Si — CID 72970803
4-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]butan-1-ol (PubChem CID 72970803) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]butan-1-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]butan-1-ol |
|---|---|
| PubChem CID | 72970803 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]butan-1-ol |
| SMILES | COc1ccc(COC(CCO)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H32O4Si/c1-18(2,3)23(5,6)22-14-17(11-12-19)21-13-15-7-9-16(20-4)10-8-15/h7-10,17,19H,11-14H2,1-6H3 |
| InChIKey | YOFYLTWCGGVBLA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|