C25H36O5Si — CID 156755731
[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]butan-2-yl] benzoate (PubChem CID 156755731) has the molecular formula C25H36O5Si and a molecular weight of 444.64 g/mol. Its IUPAC name is [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]butan-2-yl] benzoate.
| Compound Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]butan-2-yl] benzoate |
|---|---|
| PubChem CID | 156755731 |
| Molecular Formula | C25H36O5Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]butan-2-yl] benzoate |
| SMILES | COc1ccc(COCC[C@H](CO[Si](C)(C)C(C)(C)C)OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H36O5Si/c1-25(2,3)31(5,6)29-19-23(30-24(26)21-10-8-7-9-11-21)16-17-28-18-20-12-14-22(27-4)15-13-20/h7-15,23H,16-19H2,1-6H3/t23-/m1/s1 |
| InChIKey | WYLQZYSQWLVJTG-HSZRJFAPSA-N |
| XLogP | 5.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|