C26H34O5Si — CID 102522730
[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-4-phenylhexa-4,5-dien-3-yl] 4-methoxybenzoate (PubChem CID 102522730) has the molecular formula C26H34O5Si and a molecular weight of 454.64 g/mol. Its IUPAC name is [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-4-phenylhexa-4,5-dien-3-yl] 4-methoxybenzoate.
| Compound Name | [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-4-phenylhexa-4,5-dien-3-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 102522730 |
| Molecular Formula | C26H34O5Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-4-phenylhexa-4,5-dien-3-yl] 4-methoxybenzoate |
| SMILES | C=C=C(c1ccccc1)[C@H](OC(=O)c1ccc(OC)cc1)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H34O5Si/c1-8-22(19-12-10-9-11-13-19)24(23(27)18-30-32(6,7)26(2,3)4)31-25(28)20-14-16-21(29-5)17-15-20/h9-17,23-24,27H,1,18H2,2-7H3/t23-,24+/m1/s1 |
| InChIKey | ULCKEMLEFBCGSU-RPWUZVMVSA-N |
| XLogP | 5.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|