C42H64O7Si3 — CID 66559387
[(2S,4R,5R,6R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-oxoheptan-2-yl] benzoate (PubChem CID 66559387) has the molecular formula C42H64O7Si3 and a molecular weight of 765.23 g/mol. Its IUPAC name is [(2S,4R,5R,6R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-oxoheptan-2-yl] benzoate.
| Compound Name | [(2S,4R,5R,6R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-oxoheptan-2-yl] benzoate |
|---|---|
| PubChem CID | 66559387 |
| Molecular Formula | C42H64O7Si3 |
| Molecular Weight | 765.23 g/mol |
| Exact Mass | 764.40 |
| IUPAC Name | [(2S,4R,5R,6R)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-oxoheptan-2-yl] benzoate |
| SMILES | C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H](CO[Si](C)(C)C(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C42H64O7Si3/c1-31(48-52(42(8,9)10,33-26-20-16-21-27-33)34-28-22-17-23-29-34)36(43)38(49-51(13,14)41(5,6)7)37(44)35(30-46-50(11,12)40(2,3)4)47-39(45)32-24-18-15-19-25-32/h15-29,31,35-36,38,43H,30H2,1-14H3/t31-,35+,36-,38-/m1/s1 |
| InChIKey | RBRVLQCDQKZHRR-ZXUFQHJVSA-N |
| XLogP | 8.52 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.23 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|