C46H63NO6Si2 — CID 66559471
[(2S,4R,5R,6S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(dibenzylamino)-5-hydroxy-3-oxo-7-phenylheptan-2-yl] benzoate (PubChem CID 66559471) has the molecular formula C46H63NO6Si2 and a molecular weight of 782.18 g/mol. Its IUPAC name is [(2S,4R,5R,6S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(dibenzylamino)-5-hydroxy-3-oxo-7-phenylheptan-2-yl] benzoate.
| Compound Name | [(2S,4R,5R,6S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(dibenzylamino)-5-hydroxy-3-oxo-7-phenylheptan-2-yl] benzoate |
|---|---|
| PubChem CID | 66559471 |
| Molecular Formula | C46H63NO6Si2 |
| Molecular Weight | 782.18 g/mol |
| Exact Mass | 781.42 |
| IUPAC Name | [(2S,4R,5R,6S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(dibenzylamino)-5-hydroxy-3-oxo-7-phenylheptan-2-yl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](OC(=O)c1ccccc1)C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C46H63NO6Si2/c1-45(2,3)54(7,8)51-34-40(52-44(50)38-29-21-14-22-30-38)42(49)43(53-55(9,10)46(4,5)6)41(48)39(31-35-23-15-11-16-24-35)47(32-36-25-17-12-18-26-36)33-37-27-19-13-20-28-37/h11-30,39-41,43,48H,31-34H2,1-10H3/t39-,40-,41+,43+/m0/s1 |
| InChIKey | BKZIWGSGDHZTOY-CYGQURNUSA-N |
| XLogP | 9.87 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.18 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|