C33H47NO3Si2 — CID 164673972
methyl (2R,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-3-[dimethyl(phenyl)silyl]butanoate (PubChem CID 164673972) has the molecular formula C33H47NO3Si2 and a molecular weight of 561.92 g/mol. Its IUPAC name is methyl (2R,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-3-[dimethyl(phenyl)silyl]butanoate.
| Compound Name | methyl (2R,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-3-[dimethyl(phenyl)silyl]butanoate |
|---|---|
| PubChem CID | 164673972 |
| Molecular Formula | C33H47NO3Si2 |
| Molecular Weight | 561.92 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | methyl (2R,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-3-[dimethyl(phenyl)silyl]butanoate |
| SMILES | COC(=O)[C@H]([C@H](CO[Si](C)(C)C(C)(C)C)[Si](C)(C)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C33H47NO3Si2/c1-33(2,3)39(7,8)37-26-30(38(5,6)29-22-16-11-17-23-29)31(32(35)36-4)34(24-27-18-12-9-13-19-27)25-28-20-14-10-15-21-28/h9-23,30-31H,24-26H2,1-8H3/t30-,31-/m0/s1 |
| InChIKey | XKRFLWRWURKENB-CONSDPRKSA-N |
| XLogP | 7.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.92 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|