C25H39NO2Si — CID 15420140
(2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)pentan-1-ol (PubChem CID 15420140) has the molecular formula C25H39NO2Si and a molecular weight of 413.68 g/mol. Its IUPAC name is (2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)pentan-1-ol.
| Compound Name | (2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)pentan-1-ol |
|---|---|
| PubChem CID | 15420140 |
| Molecular Formula | C25H39NO2Si |
| Molecular Weight | 413.68 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | (2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)pentan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@@H](CO)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H39NO2Si/c1-25(2,3)29(4,5)28-18-12-17-24(21-27)26(19-22-13-8-6-9-14-22)20-23-15-10-7-11-16-23/h6-11,13-16,24,27H,12,17-21H2,1-5H3/t24-/m0/s1 |
| InChIKey | ZOQBUEWQTGYMOU-DEOSSOPVSA-N |
| XLogP | 5.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|