C32H50N2O5Si — CID 154638930
benzyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-3-yl]carbamate (PubChem CID 154638930) has the molecular formula C32H50N2O5Si and a molecular weight of 570.85 g/mol. Its IUPAC name is benzyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-3-yl]carbamate.
| Compound Name | benzyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-3-yl]carbamate |
|---|---|
| PubChem CID | 154638930 |
| Molecular Formula | C32H50N2O5Si |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 570.35 |
| IUPAC Name | benzyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(CCO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H50N2O5Si/c1-31(2,3)39-29(35)33-22-15-20-28(21-23-38-40(7,8)32(4,5)6)34(24-26-16-11-9-12-17-26)30(36)37-25-27-18-13-10-14-19-27/h9-14,16-19,28H,15,20-25H2,1-8H3,(H,33,35) |
| InChIKey | ZXEBQFWLNNAPBK-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|