C25H37NO4Si — CID 174054099
benzyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutan-2-yl]carbamate (PubChem CID 174054099) has the molecular formula C25H37NO4Si and a molecular weight of 443.66 g/mol. Its IUPAC name is benzyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutan-2-yl]carbamate.
| Compound Name | benzyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 174054099 |
| Molecular Formula | C25H37NO4Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | benzyl N-benzyl-N-[1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutan-2-yl]carbamate |
| SMILES | CC(O)C(CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H37NO4Si/c1-20(27)23(19-30-31(5,6)25(2,3)4)26(17-21-13-9-7-10-14-21)24(28)29-18-22-15-11-8-12-16-22/h7-16,20,23,27H,17-19H2,1-6H3 |
| InChIKey | QCTGARVWEAFWSP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|